C14H10N2 — CID 15960347
(6Z,12Z)-benzo[c][1,5]benzodiazocine (PubChem CID 15960347) has the molecular formula C14H10N2 and a molecular weight of 206.25 g/mol. Its IUPAC name is (6Z,12Z)-benzo[c][1,5]benzodiazocine.
| Compound Name | (6Z,12Z)-benzo[c][1,5]benzodiazocine |
|---|---|
| PubChem CID | 15960347 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (6Z,12Z)-benzo[c][1,5]benzodiazocine |
| SMILES | C1=c2/cccc/c2=N/C=c2/cccc/c2=N/1 |
| InChI | InChI=1S/C14H10N2/c1-3-7-13-11(5-1)9-15-14-8-4-2-6-12(14)10-16-13/h1-10H/b11-9-,12-10-,15-9-,15-14-,16-10-,16-13- |
| InChIKey | SXWMHWUFTXHTGS-GRXCUJECSA-N |
| XLogP | 0.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |