About 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol
1-(furan-2-yl)ethanone;2-methylpyridin-3-ol (PubChem CID 159604048) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol.
Molecular Properties
| Compound Name | 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol |
| PubChem CID | 159604048 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol |
| SMILES | CC(=O)c1ccco1.Cc1ncccc1O |
| InChI | InChI=1S/C6H7NO.C6H6O2/c1-5-6(8)3-2-4-7-5;1-5(7)6-3-2-4-8-6/h2-4,8H,1H3;2-4H,1H3 |
| InChIKey | MLVRWIGSQRAYNY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol?
The IUPAC name of 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol (CID 159604048) is 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol.
What is the SMILES notation for 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol?
The canonical SMILES for 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol is CC(=O)c1ccco1.Cc1ncccc1O.
What is the InChIKey of 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol?
The InChIKey is MLVRWIGSQRAYNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.C6H6O2/c1-5-6(8)3-2-4-7-5;1-5(7)6-3-2-4-8-6/h2-4,8H,1H3;2-4H,1H3.
What are the key properties of 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol?
1-(furan-2-yl)ethanone;2-methylpyridin-3-ol has a molecular weight of 219.24 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-yl)ethanone;2-methylpyridin-3-ol is sourced from PubChem (CID 159604048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).