C35H34F4O3S2 — CID 159604187
1-(3,5-difluorophenyl)-2-(3,5-dimethylphenyl)-2-hydroxyethanone;[2-(3,5-difluorophenyl)-1,3-dithian-2-yl]-(3,5-dimethylphenyl)methanol (PubChem CID 159604187) has the molecular formula C35H34F4O3S2 and a molecular weight of 642.78 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-2-(3,5-dimethylphenyl)-2-hydroxyethanone;[2-(3,5-difluorophenyl)-1,3-dithian-2-yl]-(3,5-dimethylphenyl)methanol.
| Compound Name | 1-(3,5-difluorophenyl)-2-(3,5-dimethylphenyl)-2-hydroxyethanone;[2-(3,5-difluorophenyl)-1,3-dithian-2-yl]-(3,5-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 159604187 |
| Molecular Formula | C35H34F4O3S2 |
| Molecular Weight | 642.78 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | 1-(3,5-difluorophenyl)-2-(3,5-dimethylphenyl)-2-hydroxyethanone;[2-(3,5-difluorophenyl)-1,3-dithian-2-yl]-(3,5-dimethylphenyl)methanol |
| SMILES | Cc1cc(C)cc(C(O)C(=O)c2cc(F)cc(F)c2)c1.Cc1cc(C)cc(C(O)C2(c3cc(F)cc(F)c3)SCCCS2)c1 |
| InChI | InChI=1S/C19H20F2OS2.C16H14F2O2/c1-12-6-13(2)8-14(7-12)18(22)19(23-4-3-5-24-19)15-9-16(20)11-17(21)10-15;1-9-3-10(2)5-11(4-9)15(19)16(20)12-6-13(17)8-14(18)7-12/h6-11,18,22H,3-5H2,1-2H3;3-8,15,19H,1-2H3 |
| InChIKey | MLWCHMDIIWHWQQ-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.78 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |