C22H22F4INO — CID 159605104
6-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-3-iodo-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine;ethane (PubChem CID 159605104) has the molecular formula C22H22F4INO and a molecular weight of 519.32 g/mol. Its IUPAC name is 6-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-3-iodo-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine;ethane.
| Compound Name | 6-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-3-iodo-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine;ethane |
|---|---|
| PubChem CID | 159605104 |
| Molecular Formula | C22H22F4INO |
| Molecular Weight | 519.32 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 6-[4-(2,2-difluoroethoxy)-2,6-difluorophenyl]-3-iodo-2-methylidene-5-phenyl-3,4-dihydro-1H-pyridine;ethane |
| SMILES | C=C1NC(c2c(F)cc(OCC(F)F)cc2F)=C(c2ccccc2)CC1I.CC |
| InChI | InChI=1S/C20H16F4INO.C2H6/c1-11-17(25)9-14(12-5-3-2-4-6-12)20(26-11)19-15(21)7-13(8-16(19)22)27-10-18(23)24;1-2/h2-8,17-18,26H,1,9-10H2;1-2H3 |
| InChIKey | MLZDTLJTDXFPJZ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.32 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|