C22H32O3 — CID 159606980
3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one;7,9,9-trimethyl-8-methylidene-1,4-dioxaspiro[4.5]dec-6-ene (PubChem CID 159606980) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one;7,9,9-trimethyl-8-methylidene-1,4-dioxaspiro[4.5]dec-6-ene.
| Compound Name | 3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one;7,9,9-trimethyl-8-methylidene-1,4-dioxaspiro[4.5]dec-6-ene |
|---|---|
| PubChem CID | 159606980 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 3,5,5-trimethyl-4-methylidenecyclohex-2-en-1-one;7,9,9-trimethyl-8-methylidene-1,4-dioxaspiro[4.5]dec-6-ene |
| SMILES | C=C1C(C)=CC(=O)CC1(C)C.C=C1C(C)=CC2(CC1(C)C)OCCO2 |
| InChI | InChI=1S/C12H18O2.C10H14O/c1-9-7-12(13-5-6-14-12)8-11(3,4)10(9)2;1-7-5-9(11)6-10(3,4)8(7)2/h7H,2,5-6,8H2,1,3-4H3;5H,2,6H2,1,3-4H3 |
| InChIKey | MMEYBFMRAGZIRU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |