C30H20N4O8 — CID 159607350
3-[3-(2,5-dioxopyrrol-3-yl)-4-methylphenyl]pyrrole-2,5-dione (PubChem CID 159607350) has the molecular formula C30H20N4O8 and a molecular weight of 564.51 g/mol. Its IUPAC name is 3-[3-(2,5-dioxopyrrol-3-yl)-4-methylphenyl]pyrrole-2,5-dione.
| Compound Name | 3-[3-(2,5-dioxopyrrol-3-yl)-4-methylphenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 159607350 |
| Molecular Formula | C30H20N4O8 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | 3-[3-(2,5-dioxopyrrol-3-yl)-4-methylphenyl]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=CC(=O)NC2=O)cc1C1=CC(=O)NC1=O.Cc1ccc(C2=CC(=O)NC2=O)cc1C1=CC(=O)NC1=O |
| InChI | InChI=1S/2C15H10N2O4/c2*1-7-2-3-8(10-5-12(18)16-14(10)20)4-9(7)11-6-13(19)17-15(11)21/h2*2-6H,1H3,(H,16,18,20)(H,17,19,21) |
| InChIKey | MMGCVAFJYPWBIW-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|