About 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile
1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile (PubChem CID 159608211) has the molecular formula C11H10F3N
and a molecular weight of 213.20 g/mol. Its IUPAC name is 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile |
| PubChem CID | 159608211 |
| Molecular Formula | C11H10F3N |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile |
| SMILES | C#N.FC(F)(F)c1cccc(C2CC2)c1 |
| InChI | InChI=1S/C10H9F3.CHN/c11-10(12,13)9-3-1-2-8(6-9)7-4-5-7;1-2/h1-3,6-7H,4-5H2;1H |
| InChIKey | MMIPPOXWLXUWQN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile?
The IUPAC name of 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile (CID 159608211) is 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile.
What is the SMILES notation for 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile?
The canonical SMILES for 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile is C#N.FC(F)(F)c1cccc(C2CC2)c1.
What is the InChIKey of 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile?
The InChIKey is MMIPPOXWLXUWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3.CHN/c11-10(12,13)9-3-1-2-8(6-9)7-4-5-7;1-2/h1-3,6-7H,4-5H2;1H.
What are the key properties of 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile?
1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile has a molecular weight of 213.20 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-(trifluoromethyl)benzene;formonitrile is sourced from PubChem (CID 159608211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).