C23H23ClN4O6S — CID 159608231
(Z)-but-2-enedioic acid;3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]benzoic acid (PubChem CID 159608231) has the molecular formula C23H23ClN4O6S and a molecular weight of 518.98 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]benzoic acid.
| Compound Name | (Z)-but-2-enedioic acid;3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 159608231 |
| Molecular Formula | C23H23ClN4O6S |
| Molecular Weight | 518.98 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | (Z)-but-2-enedioic acid;3-[[4-[(6-chlorothieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)/C=C\C(=O)O.O=C(O)c1cccc(CN2CCC(Nc3ncnc4sc(Cl)cc34)CC2)c1 |
| InChI | InChI=1S/C19H19ClN4O2S.C4H4O4/c20-16-9-15-17(21-11-22-18(15)27-16)23-14-4-6-24(7-5-14)10-12-2-1-3-13(8-12)19(25)26;5-3(6)1-2-4(7)8/h1-3,8-9,11,14H,4-7,10H2,(H,25,26)(H,21,22,23);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | MMIRKZKXRXDWMX-BTJKTKAUSA-N |
| XLogP | 3.83 |
| TPSA | 152.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.98 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|