C25H21FN6O — CID 159608860
1-[2-(5-fluoro-3-pyridinyl)-4-[[(3R)-2,3,4,9-tetrahydro-1H-fluoren-3-yl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]ethanone (PubChem CID 159608860) has the molecular formula C25H21FN6O and a molecular weight of 440.48 g/mol. Its IUPAC name is 1-[2-(5-fluoro-3-pyridinyl)-4-[[(3R)-2,3,4,9-tetrahydro-1H-fluoren-3-yl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]ethanone.
| Compound Name | 1-[2-(5-fluoro-3-pyridinyl)-4-[[(3R)-2,3,4,9-tetrahydro-1H-fluoren-3-yl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]ethanone |
|---|---|
| PubChem CID | 159608860 |
| Molecular Formula | C25H21FN6O |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 1-[2-(5-fluoro-3-pyridinyl)-4-[[(3R)-2,3,4,9-tetrahydro-1H-fluoren-3-yl]amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]ethanone |
| SMILES | CC(=O)c1cnn2c(N[C@@H]3CCC4=C(C3)c3ccccc3C4)nc(-c3cncc(F)c3)nc12 |
| InChI | InChI=1S/C25H21FN6O/c1-14(33)22-13-28-32-24(22)30-23(17-9-18(26)12-27-11-17)31-25(32)29-19-7-6-16-8-15-4-2-3-5-20(15)21(16)10-19/h2-5,9,11-13,19H,6-8,10H2,1H3,(H,29,30,31)/t19-/m1/s1 |
| InChIKey | MMKOEVDIFIRRAH-LJQANCHMSA-N |
| XLogP | 4.50 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |