About 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one
5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one (PubChem CID 159610105) has the molecular formula C20H36O2
and a molecular weight of 308.51 g/mol. Its IUPAC name is 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one.
Molecular Properties
| Compound Name | 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one |
| PubChem CID | 159610105 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one |
| SMILES | C=C(C)C1CCC(C)CC1O.CC(C)[C@@H]1CC[C@@H](C)CC1=O |
| InChI | InChI=1S/2C10H18O/c2*1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3;8-11H,1,4-6H2,2-3H3/t8-,9+;/m1./s1 |
| InChIKey | MMOVFQAECDNANX-RJUBDTSPSA-N |
| XLogP | 5.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one?
The IUPAC name of 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one (CID 159610105) is 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one.
What is the SMILES notation for 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one?
The canonical SMILES for 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one is C=C(C)C1CCC(C)CC1O.CC(C)[C@@H]1CC[C@@H](C)CC1=O.
What is the InChIKey of 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one?
The InChIKey is MMOVFQAECDNANX-RJUBDTSPSA-N. The full InChI is InChI=1S/2C10H18O/c2*1-7(2)9-5-4-8(3)6-10(9)11/h7-9H,4-6H2,1-3H3;8-11H,1,4-6H2,2-3H3/t8-,9+;/m1./s1.
What are the key properties of 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one?
5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one has a molecular weight of 308.51 g/mol, XLogP of 5.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-prop-1-en-2-ylcyclohexan-1-ol;trans-(2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-one is sourced from PubChem (CID 159610105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).