C16H16Cl2F2N2O2 — CID 159610259
2-(4,6-dichloro-5-methyl-3-pyridinyl)-1-(2,6-difluoro-3,5-dimethoxyphenyl)ethanamine (PubChem CID 159610259) has the molecular formula C16H16Cl2F2N2O2 and a molecular weight of 377.22 g/mol. Its IUPAC name is 2-(4,6-dichloro-5-methyl-3-pyridinyl)-1-(2,6-difluoro-3,5-dimethoxyphenyl)ethanamine.
| Compound Name | 2-(4,6-dichloro-5-methyl-3-pyridinyl)-1-(2,6-difluoro-3,5-dimethoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 159610259 |
| Molecular Formula | C16H16Cl2F2N2O2 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-(4,6-dichloro-5-methyl-3-pyridinyl)-1-(2,6-difluoro-3,5-dimethoxyphenyl)ethanamine |
| SMILES | COc1cc(OC)c(F)c(C(N)Cc2cnc(Cl)c(C)c2Cl)c1F |
| InChI | InChI=1S/C16H16Cl2F2N2O2/c1-7-13(17)8(6-22-16(7)18)4-9(21)12-14(19)10(23-2)5-11(24-3)15(12)20/h5-6,9H,4,21H2,1-3H3 |
| InChIKey | MMPGSCBNZDRDHP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|