About 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine
1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine (PubChem CID 159610411) has the molecular formula C21H15BClNO4
and a molecular weight of 391.62 g/mol. Its IUPAC name is 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine.
Molecular Properties
| Compound Name | 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine |
| PubChem CID | 159610411 |
| Molecular Formula | C21H15BClNO4 |
| Molecular Weight | 391.62 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine |
| SMILES | Clc1ccc(-c2cc3ccccc3o2)cn1.OB(O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C13H8ClNO.C8H7BO3/c14-13-6-5-10(8-15-13)12-7-9-3-1-2-4-11(9)16-12;10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-8H;1-5,10-11H |
| InChIKey | MMPUDWDTCYMJNN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.62 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine?
The IUPAC name of 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine (CID 159610411) is 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine.
What is the SMILES notation for 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine?
The canonical SMILES for 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine is Clc1ccc(-c2cc3ccccc3o2)cn1.OB(O)c1cc2ccccc2o1.
What is the InChIKey of 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine?
The InChIKey is MMPUDWDTCYMJNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClNO.C8H7BO3/c14-13-6-5-10(8-15-13)12-7-9-3-1-2-4-11(9)16-12;10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-8H;1-5,10-11H.
What are the key properties of 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine?
1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine has a molecular weight of 391.62 g/mol, XLogP of 4.26, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-ylboronic acid;5-(1-benzofuran-2-yl)-2-chloropyridine is sourced from PubChem (CID 159610411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).