About 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine
3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine (PubChem CID 159612419) has the molecular formula C17H16F3N3O
and a molecular weight of 335.33 g/mol. Its IUPAC name is 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine.
Molecular Properties
| Compound Name | 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine |
| PubChem CID | 159612419 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine |
| SMILES | C[C@@H](c1ccc(OCC(F)(F)F)nc1)c1c(N)[nH]c2ccccc12 |
| InChI | InChI=1S/C17H16F3N3O/c1-10(15-12-4-2-3-5-13(12)23-16(15)21)11-6-7-14(22-8-11)24-9-17(18,19)20/h2-8,10,23H,9,21H2,1H3/t10-/m0/s1 |
| InChIKey | TZUHRSXTAVAUEH-JTQLQIEISA-N |
| XLogP | 4.24 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine?
The IUPAC name of 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine (CID 159612419) is 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine.
What is the SMILES notation for 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine?
The canonical SMILES for 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine is C[C@@H](c1ccc(OCC(F)(F)F)nc1)c1c(N)[nH]c2ccccc12.
What is the InChIKey of 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine?
The InChIKey is TZUHRSXTAVAUEH-JTQLQIEISA-N. The full InChI is InChI=1S/C17H16F3N3O/c1-10(15-12-4-2-3-5-13(12)23-16(15)21)11-6-7-14(22-8-11)24-9-17(18,19)20/h2-8,10,23H,9,21H2,1H3/t10-/m0/s1.
What are the key properties of 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine?
3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine has a molecular weight of 335.33 g/mol, XLogP of 4.24, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S)-1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]-1H-indol-2-amine is sourced from PubChem (CID 159612419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).