About 3-amino-1-cyclohexyl-1-methylthiourea;copper
3-amino-1-cyclohexyl-1-methylthiourea;copper (PubChem CID 159613247) has the molecular formula C8H17CuN3S
and a molecular weight of 250.86 g/mol. Its IUPAC name is 3-amino-1-cyclohexyl-1-methylthiourea;copper.
Molecular Properties
| Compound Name | 3-amino-1-cyclohexyl-1-methylthiourea;copper |
| PubChem CID | 159613247 |
| Molecular Formula | C8H17CuN3S |
| Molecular Weight | 250.86 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 3-amino-1-cyclohexyl-1-methylthiourea;copper |
| SMILES | CN(C(=S)NN)C1CCCCC1.[Cu] |
| InChI | InChI=1S/C8H17N3S.Cu/c1-11(8(12)10-9)7-5-3-2-4-6-7;/h7H,2-6,9H2,1H3,(H,10,12); |
| InChIKey | MMYWTYZFCRGYRU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.86 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-1-cyclohexyl-1-methylthiourea;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-cyclohexyl-1-methylthiourea;copper?
The IUPAC name of 3-amino-1-cyclohexyl-1-methylthiourea;copper (CID 159613247) is 3-amino-1-cyclohexyl-1-methylthiourea;copper.
What is the SMILES notation for 3-amino-1-cyclohexyl-1-methylthiourea;copper?
The canonical SMILES for 3-amino-1-cyclohexyl-1-methylthiourea;copper is CN(C(=S)NN)C1CCCCC1.[Cu].
What is the InChIKey of 3-amino-1-cyclohexyl-1-methylthiourea;copper?
The InChIKey is MMYWTYZFCRGYRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3S.Cu/c1-11(8(12)10-9)7-5-3-2-4-6-7;/h7H,2-6,9H2,1H3,(H,10,12);.
What are the key properties of 3-amino-1-cyclohexyl-1-methylthiourea;copper?
3-amino-1-cyclohexyl-1-methylthiourea;copper has a molecular weight of 250.86 g/mol, XLogP of 1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-cyclohexyl-1-methylthiourea;copper is sourced from PubChem (CID 159613247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).