C28H45Br2NO5S — CID 159613399
1-bromo-4-(7-methoxyheptyl)benzene;3-(4-bromophenyl)propyl methanesulfonate;3-methoxypropan-1-amine (PubChem CID 159613399) has the molecular formula C28H45Br2NO5S and a molecular weight of 667.55 g/mol. Its IUPAC name is 1-bromo-4-(7-methoxyheptyl)benzene;3-(4-bromophenyl)propyl methanesulfonate;3-methoxypropan-1-amine.
| Compound Name | 1-bromo-4-(7-methoxyheptyl)benzene;3-(4-bromophenyl)propyl methanesulfonate;3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 159613399 |
| Molecular Formula | C28H45Br2NO5S |
| Molecular Weight | 667.55 g/mol |
| Exact Mass | 665.14 |
| IUPAC Name | 1-bromo-4-(7-methoxyheptyl)benzene;3-(4-bromophenyl)propyl methanesulfonate;3-methoxypropan-1-amine |
| SMILES | COCCCCCCCc1ccc(Br)cc1.COCCCN.CS(=O)(=O)OCCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H21BrO.C10H13BrO3S.C4H11NO/c1-16-12-6-4-2-3-5-7-13-8-10-14(15)11-9-13;1-15(12,13)14-8-2-3-9-4-6-10(11)7-5-9;1-6-4-2-3-5/h8-11H,2-7,12H2,1H3;4-7H,2-3,8H2,1H3;2-5H2,1H3 |
| InChIKey | MMZJNLUFLBWVFH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.55 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|