C53H74NO12- — CID 159613827
carbanide;5-[5-(3,5-dimethylbenzoyl)oxypentylamino]pentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene (PubChem CID 159613827) has the molecular formula C53H74NO12- and a molecular weight of 917.17 g/mol. Its IUPAC name is carbanide;5-[5-(3,5-dimethylbenzoyl)oxypentylamino]pentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene.
| Compound Name | carbanide;5-[5-(3,5-dimethylbenzoyl)oxypentylamino]pentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene |
|---|---|
| PubChem CID | 159613827 |
| Molecular Formula | C53H74NO12- |
| Molecular Weight | 917.17 g/mol |
| Exact Mass | 916.52 |
| IUPAC Name | carbanide;5-[5-(3,5-dimethylbenzoyl)oxypentylamino]pentyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene |
| SMILES | Cc1cc(C)cc(C(=O)OCCCCCNCCCCCOC(=O)c2cc(C)cc(C)c2)c1.[CH3-].c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C28H39NO4.C24H32O8.CH3/c1-21-15-22(2)18-25(17-21)27(30)32-13-9-5-7-11-29-12-8-6-10-14-33-28(31)26-19-23(3)16-24(4)20-26;1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22;/h15-20,29H,5-14H2,1-4H3;1-8H,9-20H2;1H3/q;;-1 |
| InChIKey | MNAORZQXHAYXOI-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.17 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|