C22H22BrCl2F3O8S2 — CID 159614484
2-cyclohexyloxyethyl 4-[(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate;2,2,2-trifluoroacetic acid (PubChem CID 159614484) has the molecular formula C22H22BrCl2F3O8S2 and a molecular weight of 686.35 g/mol. Its IUPAC name is 2-cyclohexyloxyethyl 4-[(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-cyclohexyloxyethyl 4-[(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159614484 |
| Molecular Formula | C22H22BrCl2F3O8S2 |
| Molecular Weight | 686.35 g/mol |
| Exact Mass | 683.93 |
| IUPAC Name | 2-cyclohexyloxyethyl 4-[(4-bromo-2,5-dichlorothiophen-3-yl)sulfonylmethyl]-2-hydroxybenzoate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(OCCOC1CCCCC1)c1ccc(CS(=O)(=O)c2c(Cl)sc(Cl)c2Br)cc1O |
| InChI | InChI=1S/C20H21BrCl2O6S2.C2HF3O2/c21-16-17(19(23)30-18(16)22)31(26,27)11-12-6-7-14(15(24)10-12)20(25)29-9-8-28-13-4-2-1-3-5-13;3-2(4,5)1(6)7/h6-7,10,13,24H,1-5,8-9,11H2;(H,6,7) |
| InChIKey | PZUQQDHDMYBERN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.35 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|