C23H13F6N7O2 — CID 159614550
5-[2-cyano-1-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]ethyl]pyridine-3-carbonitrile;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 159614550) has the molecular formula C23H13F6N7O2 and a molecular weight of 533.39 g/mol. Its IUPAC name is 5-[2-cyano-1-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]ethyl]pyridine-3-carbonitrile;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | 5-[2-cyano-1-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]ethyl]pyridine-3-carbonitrile;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 159614550 |
| Molecular Formula | C23H13F6N7O2 |
| Molecular Weight | 533.39 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 5-[2-cyano-1-[4-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrazol-1-yl]ethyl]pyridine-3-carbonitrile;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | N#CCC(c1cncc(C#N)c1)n1cc(-c2ccnc3[nH]ccc23)cn1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H13N7.C4F6O2/c20-4-1-18(14-7-13(8-21)9-22-10-14)26-12-15(11-25-26)16-2-5-23-19-17(16)3-6-24-19;5-3(6,7)1(11)2(12)4(8,9)10/h2-3,5-7,9-12,18H,1H2,(H,23,24); |
| InChIKey | MNCUZAUPAPMJEW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|