C30H37Cl7O10S2 — CID 159614610
2,2,2-trichloroethyl 6-(2-chloro-4-formylphenoxy)hexane-1-sulfonate;2,2,2-trichloroethyl 6-(4-formylphenoxy)hexane-1-sulfonate (PubChem CID 159614610) has the molecular formula C30H37Cl7O10S2 and a molecular weight of 869.92 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 6-(2-chloro-4-formylphenoxy)hexane-1-sulfonate;2,2,2-trichloroethyl 6-(4-formylphenoxy)hexane-1-sulfonate.
| Compound Name | 2,2,2-trichloroethyl 6-(2-chloro-4-formylphenoxy)hexane-1-sulfonate;2,2,2-trichloroethyl 6-(4-formylphenoxy)hexane-1-sulfonate |
|---|---|
| PubChem CID | 159614610 |
| Molecular Formula | C30H37Cl7O10S2 |
| Molecular Weight | 869.92 g/mol |
| Exact Mass | 865.96 |
| IUPAC Name | 2,2,2-trichloroethyl 6-(2-chloro-4-formylphenoxy)hexane-1-sulfonate;2,2,2-trichloroethyl 6-(4-formylphenoxy)hexane-1-sulfonate |
| SMILES | O=Cc1ccc(OCCCCCCS(=O)(=O)OCC(Cl)(Cl)Cl)c(Cl)c1.O=Cc1ccc(OCCCCCCS(=O)(=O)OCC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C15H18Cl4O5S.C15H19Cl3O5S/c16-13-9-12(10-20)5-6-14(13)23-7-3-1-2-4-8-25(21,22)24-11-15(17,18)19;16-15(17,18)12-23-24(20,21)10-4-2-1-3-9-22-14-7-5-13(11-19)6-8-14/h5-6,9-10H,1-4,7-8,11H2;5-8,11H,1-4,9-10,12H2 |
| InChIKey | MNCZMPFGMDBSFI-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.92 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|