About 1-adamantylazanium;hydrogen carbonate
1-adamantylazanium;hydrogen carbonate (PubChem CID 159615620) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-adamantylazanium;hydrogen carbonate.
Molecular Properties
| Compound Name | 1-adamantylazanium;hydrogen carbonate |
| PubChem CID | 159615620 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 1-adamantylazanium;hydrogen carbonate |
| SMILES | O=C([O-])O.[NH3+]C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H17N.CH2O3/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;2-1(3)4/h7-9H,1-6,11H2;(H2,2,3,4) |
| InChIKey | MNGAYODFWMSCMV-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-adamantylazanium;hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantylazanium;hydrogen carbonate?
The IUPAC name of 1-adamantylazanium;hydrogen carbonate (CID 159615620) is 1-adamantylazanium;hydrogen carbonate.
What is the SMILES notation for 1-adamantylazanium;hydrogen carbonate?
The canonical SMILES for 1-adamantylazanium;hydrogen carbonate is O=C([O-])O.[NH3+]C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1-adamantylazanium;hydrogen carbonate?
The InChIKey is MNGAYODFWMSCMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.CH2O3/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;2-1(3)4/h7-9H,1-6,11H2;(H2,2,3,4).
What are the key properties of 1-adamantylazanium;hydrogen carbonate?
1-adamantylazanium;hydrogen carbonate has a molecular weight of 213.28 g/mol, XLogP of 0.08, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantylazanium;hydrogen carbonate is sourced from PubChem (CID 159615620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).