C20H20Br2N2O7S — CID 159616261
methyl 2-(3-bromo-4-methoxyanilino)-2-oxoacetate;methyl 2-(3-bromo-4-methoxyanilino)-2-sulfanylideneacetate (PubChem CID 159616261) has the molecular formula C20H20Br2N2O7S and a molecular weight of 592.26 g/mol. Its IUPAC name is methyl 2-(3-bromo-4-methoxyanilino)-2-oxoacetate;methyl 2-(3-bromo-4-methoxyanilino)-2-sulfanylideneacetate.
| Compound Name | methyl 2-(3-bromo-4-methoxyanilino)-2-oxoacetate;methyl 2-(3-bromo-4-methoxyanilino)-2-sulfanylideneacetate |
|---|---|
| PubChem CID | 159616261 |
| Molecular Formula | C20H20Br2N2O7S |
| Molecular Weight | 592.26 g/mol |
| Exact Mass | 589.94 |
| IUPAC Name | methyl 2-(3-bromo-4-methoxyanilino)-2-oxoacetate;methyl 2-(3-bromo-4-methoxyanilino)-2-sulfanylideneacetate |
| SMILES | COC(=O)C(=O)Nc1ccc(OC)c(Br)c1.COC(=O)C(=S)Nc1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C10H10BrNO4.C10H10BrNO3S/c1-15-8-4-3-6(5-7(8)11)12-9(13)10(14)16-2;1-14-8-4-3-6(5-7(8)11)12-9(16)10(13)15-2/h3-5H,1-2H3,(H,12,13);3-5H,1-2H3,(H,12,16) |
| InChIKey | MNIAIERWEGGLRZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|