About 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone
6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone (PubChem CID 159616809) has the molecular formula C18H11F3N4O5
and a molecular weight of 420.30 g/mol. Its IUPAC name is 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone.
Molecular Properties
| Compound Name | 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone |
| PubChem CID | 159616809 |
| Molecular Formula | C18H11F3N4O5 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone |
| SMILES | O=C(c1c[nH]c2cc([N+](=O)[O-])ccc12)C(F)(F)F.O=[N+]([O-])c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C10H5F3N2O3.C8H6N2O2/c11-10(12,13)9(16)7-4-14-8-3-5(15(17)18)1-2-6(7)8;11-10(12)7-2-1-6-3-4-9-8(6)5-7/h1-4,14H;1-5,9H |
| InChIKey | MNJPNYRNRGRNHF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone?
The IUPAC name of 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone (CID 159616809) is 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone.
What is the SMILES notation for 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone?
The canonical SMILES for 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone is O=C(c1c[nH]c2cc([N+](=O)[O-])ccc12)C(F)(F)F.O=[N+]([O-])c1ccc2cc[nH]c2c1.
What is the InChIKey of 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone?
The InChIKey is MNJPNYRNRGRNHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F3N2O3.C8H6N2O2/c11-10(12,13)9(16)7-4-14-8-3-5(15(17)18)1-2-6(7)8;11-10(12)7-2-1-6-3-4-9-8(6)5-7/h1-4,14H;1-5,9H.
What are the key properties of 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone?
6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone has a molecular weight of 420.30 g/mol, XLogP of 4.90, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-1H-indole;2,2,2-trifluoro-1-(6-nitro-1H-indol-3-yl)ethanone is sourced from PubChem (CID 159616809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).