C17H24N6O2S — CID 15961687
1-oxo-3-N-[(E)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]-1,2,5-thiadiazole-3,4-diamine (PubChem CID 15961687) has the molecular formula C17H24N6O2S and a molecular weight of 376.49 g/mol. Its IUPAC name is 1-oxo-3-N-[(E)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 1-oxo-3-N-[(E)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 15961687 |
| Molecular Formula | C17H24N6O2S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-oxo-3-N-[(E)-4-[[4-(piperidin-1-ylmethyl)-2-pyridinyl]oxy]but-2-enyl]-1,2,5-thiadiazole-3,4-diamine |
| SMILES | NC1=NS(=O)N=C1NC/C=C/COc1cc(CN2CCCCC2)ccn1 |
| InChI | InChI=1S/C17H24N6O2S/c18-16-17(22-26(24)21-16)20-7-2-5-11-25-15-12-14(6-8-19-15)13-23-9-3-1-4-10-23/h2,5-6,8,12H,1,3-4,7,9-11,13H2,(H2,18,21)(H,20,22)/b5-2+ |
| InChIKey | FREFVQDHTGTCTB-GORDUTHDSA-N |
| XLogP | 0.94 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|