C14H20N6O2S — CID 15961694
3-N-[(Z)-4-[[4-[(dimethylamino)methyl]-2-pyridinyl]oxy]but-2-enyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine (PubChem CID 15961694) has the molecular formula C14H20N6O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 3-N-[(Z)-4-[[4-[(dimethylamino)methyl]-2-pyridinyl]oxy]but-2-enyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine.
| Compound Name | 3-N-[(Z)-4-[[4-[(dimethylamino)methyl]-2-pyridinyl]oxy]but-2-enyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine |
|---|---|
| PubChem CID | 15961694 |
| Molecular Formula | C14H20N6O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 3-N-[(Z)-4-[[4-[(dimethylamino)methyl]-2-pyridinyl]oxy]but-2-enyl]-1-oxo-1,2,5-thiadiazole-3,4-diamine |
| SMILES | CN(C)Cc1ccnc(OC/C=C\CNC2=NS(=O)N=C2N)c1 |
| InChI | InChI=1S/C14H20N6O2S/c1-20(2)10-11-5-7-16-12(9-11)22-8-4-3-6-17-14-13(15)18-23(21)19-14/h3-5,7,9H,6,8,10H2,1-2H3,(H2,15,18)(H,17,19)/b4-3- |
| InChIKey | SAMIQTGHBCEWFY-ARJAWSKDSA-N |
| XLogP | 0.02 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|