C37H27BF4O2 — CID 15961739
2-[(E,3E)-3-(4,6-diphenylpyran-2-ylidene)prop-1-enyl]-4,6-diphenylpyrylium tetrafluoroborate (PubChem CID 15961739) has the molecular formula C37H27BF4O2 and a molecular weight of 590.43 g/mol. Its IUPAC name is 2-[(E,3E)-3-(4,6-diphenylpyran-2-ylidene)prop-1-enyl]-4,6-diphenylpyrylium tetrafluoroborate.
| Compound Name | 2-[(E,3E)-3-(4,6-diphenylpyran-2-ylidene)prop-1-enyl]-4,6-diphenylpyrylium tetrafluoroborate |
|---|---|
| PubChem CID | 15961739 |
| Molecular Formula | C37H27BF4O2 |
| Molecular Weight | 590.43 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 2-[(E,3E)-3-(4,6-diphenylpyran-2-ylidene)prop-1-enyl]-4,6-diphenylpyrylium tetrafluoroborate |
| SMILES | C1=C(c2ccccc2)C=C(c2ccccc2)O/C1=C/C=C/c1cc(-c2ccccc2)cc(-c2ccccc2)[o+]1.F[B-](F)(F)F |
| InChI | InChI=1S/C37H27O2.BF4/c1-5-14-28(15-6-1)32-24-34(38-36(26-32)30-18-9-3-10-19-30)22-13-23-35-25-33(29-16-7-2-8-17-29)27-37(39-35)31-20-11-4-12-21-31;2-1(3,4)5/h1-27H;/q+1;-1 |
| InChIKey | ONTKELDDWHIYQT-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.43 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|