About methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole
methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole (PubChem CID 159617435) has the molecular formula C19H41N2+
and a molecular weight of 297.55 g/mol. Its IUPAC name is methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole.
Molecular Properties
| Compound Name | methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole |
| PubChem CID | 159617435 |
| Molecular Formula | C19H41N2+ |
| Molecular Weight | 297.55 g/mol |
| Exact Mass | 297.33 |
| IUPAC Name | methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole |
| SMILES | C.C.C.C.C.C.CN1C=CC(=CC=CC2=CC=[N+](C)C2)C1 |
| InChI | InChI=1S/C13H17N2.6CH4/c1-14-8-6-12(10-14)4-3-5-13-7-9-15(2)11-13;;;;;;/h3-9H,10-11H2,1-2H3;6*1H4/q+1;;;;;; |
| InChIKey | MNLOFYVFGLSHAM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole?
The IUPAC name of methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole (CID 159617435) is methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole.
What is the SMILES notation for methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole?
The canonical SMILES for methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole is C.C.C.C.C.C.CN1C=CC(=CC=CC2=CC=[N+](C)C2)C1.
What is the InChIKey of methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole?
The InChIKey is MNLOFYVFGLSHAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N2.6CH4/c1-14-8-6-12(10-14)4-3-5-13-7-9-15(2)11-13;;;;;;/h3-9H,10-11H2,1-2H3;6*1H4/q+1;;;;;;.
What are the key properties of methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole?
methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole has a molecular weight of 297.55 g/mol, XLogP of 5.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-3-[3-(1-methyl-2H-pyrrol-1-ium-3-yl)prop-2-enylidene]-2H-pyrrole is sourced from PubChem (CID 159617435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).