C28H65F3 — CID 159617675
3,5-difluoro-2,7-dimethylocta-3,5-diene;3-fluoro-2,7-dimethylocta-3,5-diene;methane (PubChem CID 159617675) has the molecular formula C28H65F3 and a molecular weight of 458.82 g/mol. Its IUPAC name is 3,5-difluoro-2,7-dimethylocta-3,5-diene;3-fluoro-2,7-dimethylocta-3,5-diene;methane.
| Compound Name | 3,5-difluoro-2,7-dimethylocta-3,5-diene;3-fluoro-2,7-dimethylocta-3,5-diene;methane |
|---|---|
| PubChem CID | 159617675 |
| Molecular Formula | C28H65F3 |
| Molecular Weight | 458.82 g/mol |
| Exact Mass | 458.50 |
| IUPAC Name | 3,5-difluoro-2,7-dimethylocta-3,5-diene;3-fluoro-2,7-dimethylocta-3,5-diene;methane |
| SMILES | C.C.C.C.C.C.C.C.CC(C)C=C(F)C=C(F)C(C)C.CC(C)C=CC=C(F)C(C)C |
| InChI | InChI=1S/C10H16F2.C10H17F.8CH4/c1-7(2)5-9(11)6-10(12)8(3)4;1-8(2)6-5-7-10(11)9(3)4;;;;;;;;/h5-8H,1-4H3;5-9H,1-4H3;8*1H4 |
| InChIKey | MNMIJNDJOVGKJY-UHFFFAOYSA-N |
| XLogP | 12.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.82 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|