molecular iodine;trimethylphosphane

C3H9I2P — CID 159618036

IUPACmolecular iodine;trimethylphosphane
SMILESCP(C)C.II
InChIInChI=1S/C3H9P.I2/c1-4(2)3;1-2/h1-3H3;
InChIKeyMNNNAZLTTVNDAD-UHFFFAOYSA-N
MW329.89 g/mol
LogP3.13
Rot. Bonds

About molecular iodine;trimethylphosphane

molecular iodine;trimethylphosphane (PubChem CID 159618036) has the molecular formula C3H9I2P and a molecular weight of 329.89 g/mol. Its IUPAC name is molecular iodine;trimethylphosphane.

Molecular Properties

Compound Namemolecular iodine;trimethylphosphane
PubChem CID159618036
Molecular FormulaC3H9I2P
Molecular Weight329.89 g/mol
Exact Mass329.85
IUPAC Namemolecular iodine;trimethylphosphane
SMILESCP(C)C.II
InChIInChI=1S/C3H9P.I2/c1-4(2)3;1-2/h1-3H3;
InChIKeyMNNNAZLTTVNDAD-UHFFFAOYSA-N
XLogP3.13
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms6
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.89
LogP ≤ 53.13
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze molecular iodine;trimethylphosphane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular iodine;trimethylphosphane?
The IUPAC name of molecular iodine;trimethylphosphane (CID 159618036) is molecular iodine;trimethylphosphane.
What is the SMILES notation for molecular iodine;trimethylphosphane?
The canonical SMILES for molecular iodine;trimethylphosphane is CP(C)C.II.
What is the InChIKey of molecular iodine;trimethylphosphane?
The InChIKey is MNNNAZLTTVNDAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9P.I2/c1-4(2)3;1-2/h1-3H3;.
What are the key properties of molecular iodine;trimethylphosphane?
molecular iodine;trimethylphosphane has a molecular weight of 329.89 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for molecular iodine;trimethylphosphane is sourced from PubChem (CID 159618036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).