C40H48 — CID 159618631
4-(3,4-dimethylphenyl)-1,2-dimethylbenzene;1,2,4,5-tetramethylbenzene;2,3,6,7-tetramethylnaphthalene (PubChem CID 159618631) has the molecular formula C40H48 and a molecular weight of 528.82 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene;1,2,4,5-tetramethylbenzene;2,3,6,7-tetramethylnaphthalene.
| Compound Name | 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene;1,2,4,5-tetramethylbenzene;2,3,6,7-tetramethylnaphthalene |
|---|---|
| PubChem CID | 159618631 |
| Molecular Formula | C40H48 |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-1,2-dimethylbenzene;1,2,4,5-tetramethylbenzene;2,3,6,7-tetramethylnaphthalene |
| SMILES | Cc1cc(C)c(C)cc1C.Cc1cc2cc(C)c(C)cc2cc1C.Cc1ccc(-c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C16H18.C14H16.C10H14/c1-11-5-7-15(9-13(11)3)16-8-6-12(2)14(4)10-16;1-9-5-13-7-11(3)12(4)8-14(13)6-10(9)2;1-7-5-9(3)10(4)6-8(7)2/h5-10H,1-4H3;5-8H,1-4H3;5-6H,1-4H3 |
| InChIKey | MNPKVFXZUSNIGI-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |