C17H26O9 — CID 159618722
1-acetyloxyethyl 2-methylpropanoate;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-methylpropanoate (PubChem CID 159618722) has the molecular formula C17H26O9 and a molecular weight of 374.39 g/mol. Its IUPAC name is 1-acetyloxyethyl 2-methylpropanoate;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-methylpropanoate.
| Compound Name | 1-acetyloxyethyl 2-methylpropanoate;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 159618722 |
| Molecular Formula | C17H26O9 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-acetyloxyethyl 2-methylpropanoate;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-methylpropanoate |
| SMILES | CC(=O)OC(C)OC(=O)C(C)C.Cc1oc(=O)oc1COC(=O)C(C)C |
| InChI | InChI=1S/C9H12O5.C8H14O4/c1-5(2)8(10)12-4-7-6(3)13-9(11)14-7;1-5(2)8(10)12-7(4)11-6(3)9/h5H,4H2,1-3H3;5,7H,1-4H3 |
| InChIKey | MNPRGAJDIDDBQU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 122.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|