C23H31N5O6 — CID 159619861
4-tert-butyl-N-(6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl)benzamide;formic acid;hydroperoxymethane (PubChem CID 159619861) has the molecular formula C23H31N5O6 and a molecular weight of 473.53 g/mol. Its IUPAC name is 4-tert-butyl-N-(6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl)benzamide;formic acid;hydroperoxymethane.
| Compound Name | 4-tert-butyl-N-(6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl)benzamide;formic acid;hydroperoxymethane |
|---|---|
| PubChem CID | 159619861 |
| Molecular Formula | C23H31N5O6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 4-tert-butyl-N-(6-morpholin-4-ylimidazo[1,2-b]pyridazin-2-yl)benzamide;formic acid;hydroperoxymethane |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cn3nc(N4CCOCC4)ccc3n2)cc1.COO.O=CO |
| InChI | InChI=1S/C21H25N5O2.CH4O2.CH2O2/c1-21(2,3)16-6-4-15(5-7-16)20(27)23-17-14-26-18(22-17)8-9-19(24-26)25-10-12-28-13-11-25;1-3-2;2-1-3/h4-9,14H,10-13H2,1-3H3,(H,23,27);2H,1H3;1H,(H,2,3) |
| InChIKey | MNTIEVKRWVEHPG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 138.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|