C24H19Cl3N6O4 — CID 159620050
methyl 7-chloro-5-(2-phenylethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate;methyl 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate (PubChem CID 159620050) has the molecular formula C24H19Cl3N6O4 and a molecular weight of 561.81 g/mol. Its IUPAC name is methyl 7-chloro-5-(2-phenylethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate;methyl 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate.
| Compound Name | methyl 7-chloro-5-(2-phenylethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate;methyl 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate |
|---|---|
| PubChem CID | 159620050 |
| Molecular Formula | C24H19Cl3N6O4 |
| Molecular Weight | 561.81 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | methyl 7-chloro-5-(2-phenylethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate;methyl 5,7-dichloro-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylate |
| SMILES | COC(=O)c1c(Cl)cc(CCc2ccccc2)n2ncnc12.COC(=O)c1c(Cl)cc(Cl)n2ncnc12 |
| InChI | InChI=1S/C16H14ClN3O2.C8H5Cl2N3O2/c1-22-16(21)14-13(17)9-12(20-15(14)18-10-19-20)8-7-11-5-3-2-4-6-11;1-15-8(14)6-4(9)2-5(10)13-7(6)11-3-12-13/h2-6,9-10H,7-8H2,1H3;2-3H,1H3 |
| InChIKey | MNTZHNPBVCCWCZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 112.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|