About oxolane-2,5-dione;zinc
oxolane-2,5-dione;zinc (PubChem CID 159620051) has the molecular formula C4H4O3Zn
and a molecular weight of 165.46 g/mol. Its IUPAC name is oxolane-2,5-dione;zinc.
Molecular Properties
| Compound Name | oxolane-2,5-dione;zinc |
| PubChem CID | 159620051 |
| Molecular Formula | C4H4O3Zn |
| Molecular Weight | 165.46 g/mol |
| Exact Mass | 163.95 |
| IUPAC Name | oxolane-2,5-dione;zinc |
| SMILES | O=C1CCC(=O)O1.[Zn] |
| InChI | InChI=1S/C4H4O3.Zn/c5-3-1-2-4(6)7-3;/h1-2H2; |
| InChIKey | MNTZIWJONZIMFJ-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.46 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze oxolane-2,5-dione;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane-2,5-dione;zinc?
The IUPAC name of oxolane-2,5-dione;zinc (CID 159620051) is oxolane-2,5-dione;zinc.
What is the SMILES notation for oxolane-2,5-dione;zinc?
The canonical SMILES for oxolane-2,5-dione;zinc is O=C1CCC(=O)O1.[Zn].
What is the InChIKey of oxolane-2,5-dione;zinc?
The InChIKey is MNTZIWJONZIMFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O3.Zn/c5-3-1-2-4(6)7-3;/h1-2H2;.
What are the key properties of oxolane-2,5-dione;zinc?
oxolane-2,5-dione;zinc has a molecular weight of 165.46 g/mol, XLogP of -0.15, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane-2,5-dione;zinc is sourced from PubChem (CID 159620051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).