C28H32Cl4N2O3 — CID 159621893
cyclopent-3-en-1-yl-[4-(3,4-dichlorophenoxy)piperidin-1-yl]methanone;1-(3,4-dichlorophenoxy)piperidine (PubChem CID 159621893) has the molecular formula C28H32Cl4N2O3 and a molecular weight of 586.39 g/mol. Its IUPAC name is cyclopent-3-en-1-yl-[4-(3,4-dichlorophenoxy)piperidin-1-yl]methanone;1-(3,4-dichlorophenoxy)piperidine.
| Compound Name | cyclopent-3-en-1-yl-[4-(3,4-dichlorophenoxy)piperidin-1-yl]methanone;1-(3,4-dichlorophenoxy)piperidine |
|---|---|
| PubChem CID | 159621893 |
| Molecular Formula | C28H32Cl4N2O3 |
| Molecular Weight | 586.39 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | cyclopent-3-en-1-yl-[4-(3,4-dichlorophenoxy)piperidin-1-yl]methanone;1-(3,4-dichlorophenoxy)piperidine |
| SMILES | Clc1ccc(ON2CCCCC2)cc1Cl.O=C(C1CC=CC1)N1CCC(Oc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H19Cl2NO2.C11H13Cl2NO/c18-15-6-5-14(11-16(15)19)22-13-7-9-20(10-8-13)17(21)12-3-1-2-4-12;12-10-5-4-9(8-11(10)13)15-14-6-2-1-3-7-14/h1-2,5-6,11-13H,3-4,7-10H2;4-5,8H,1-3,6-7H2 |
| InChIKey | MNZLRFRFULTDLZ-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.39 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|