About 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole
1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole (PubChem CID 159621936) has the molecular formula C19H15F6IN4O2
and a molecular weight of 572.25 g/mol. Its IUPAC name is 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole.
Molecular Properties
| Compound Name | 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole |
| PubChem CID | 159621936 |
| Molecular Formula | C19H15F6IN4O2 |
| Molecular Weight | 572.25 g/mol |
| Exact Mass | 572.01 |
| IUPAC Name | 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole |
| SMILES | Cc1nn(C)c2ccc(OC(F)(F)F)cc12.Cn1nc(I)c2cc(OC(F)(F)F)ccc21 |
| InChI | InChI=1S/C10H9F3N2O.C9H6F3IN2O/c1-6-8-5-7(16-10(11,12)13)3-4-9(8)15(2)14-6;1-15-7-3-2-5(16-9(10,11)12)4-6(7)8(13)14-15/h3-5H,1-2H3;2-4H,1H3 |
| InChIKey | MNZQEVUZQPXCAH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.25 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole?
The IUPAC name of 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole (CID 159621936) is 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole.
What is the SMILES notation for 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole?
The canonical SMILES for 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole is Cc1nn(C)c2ccc(OC(F)(F)F)cc12.Cn1nc(I)c2cc(OC(F)(F)F)ccc21.
What is the InChIKey of 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole?
The InChIKey is MNZQEVUZQPXCAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2O.C9H6F3IN2O/c1-6-8-5-7(16-10(11,12)13)3-4-9(8)15(2)14-6;1-15-7-3-2-5(16-9(10,11)12)4-6(7)8(13)14-15/h3-5H,1-2H3;2-4H,1H3.
What are the key properties of 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole?
1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole has a molecular weight of 572.25 g/mol, XLogP of 5.86, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-(trifluoromethoxy)indazole;3-iodo-1-methyl-5-(trifluoromethoxy)indazole is sourced from PubChem (CID 159621936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).