C19H26N2O3 — CID 159621945
N-[(2S)-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxyamino]-1-oxobutan-2-yl]pentalene-1-carboxamide (PubChem CID 159621945) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[(2S)-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxyamino]-1-oxobutan-2-yl]pentalene-1-carboxamide.
| Compound Name | N-[(2S)-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxyamino]-1-oxobutan-2-yl]pentalene-1-carboxamide |
|---|---|
| PubChem CID | 159621945 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | N-[(2S)-3,3-dimethyl-1-[(2-methylpropan-2-yl)oxyamino]-1-oxobutan-2-yl]pentalene-1-carboxamide |
| SMILES | CC(C)(C)ONC(=O)[C@@H](NC(=O)C1=C2C=CC=C2C=C1)C(C)(C)C |
| InChI | InChI=1S/C19H26N2O3/c1-18(2,3)15(17(23)21-24-19(4,5)6)20-16(22)14-11-10-12-8-7-9-13(12)14/h7-11,15H,1-6H3,(H,20,22)(H,21,23)/t15-/m1/s1 |
| InChIKey | MNZRSTXGIQRDJO-OAHLLOKOSA-N |
| XLogP | 2.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|