About 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium)
4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium) (PubChem CID 159623116) has the molecular formula C13H18FNY5
and a molecular weight of 651.82 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium).
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium) |
| PubChem CID | 159623116 |
| Molecular Formula | C13H18FNY5 |
| Molecular Weight | 651.82 g/mol |
| Exact Mass | 651.67 |
| IUPAC Name | 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium) |
| SMILES | CC1(C)CNCCC1c1ccc(F)cc1.[Y].[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C13H18FN.5Y/c1-13(2)9-15-8-7-12(13)10-3-5-11(14)6-4-10;;;;;/h3-6,12,15H,7-9H2,1-2H3;;;;; |
| InChIKey | MODKEIIIEDPKNR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 651.82 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium)?
The IUPAC name of 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium) (CID 159623116) is 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium).
What is the SMILES notation for 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium)?
The canonical SMILES for 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium) is CC1(C)CNCCC1c1ccc(F)cc1.[Y].[Y].[Y].[Y].[Y].
What is the InChIKey of 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium)?
The InChIKey is MODKEIIIEDPKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN.5Y/c1-13(2)9-15-8-7-12(13)10-3-5-11(14)6-4-10;;;;;/h3-6,12,15H,7-9H2,1-2H3;;;;;.
What are the key properties of 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium)?
4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium) has a molecular weight of 651.82 g/mol, XLogP of 2.92, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-3,3-dimethylpiperidine;pentakis(yttrium) is sourced from PubChem (CID 159623116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).