C10H18F3NO2 — CID 159623144
2-[2-(1,1,1-trifluoropent-4-en-2-yloxy)propan-2-ylamino]ethanol (PubChem CID 159623144) has the molecular formula C10H18F3NO2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[2-(1,1,1-trifluoropent-4-en-2-yloxy)propan-2-ylamino]ethanol.
| Compound Name | 2-[2-(1,1,1-trifluoropent-4-en-2-yloxy)propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 159623144 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-[2-(1,1,1-trifluoropent-4-en-2-yloxy)propan-2-ylamino]ethanol |
| SMILES | C=CCC(OC(C)(C)NCCO)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2/c1-4-5-8(10(11,12)13)16-9(2,3)14-6-7-15/h4,8,14-15H,1,5-7H2,2-3H3 |
| InChIKey | MODMVGIBPNYLMU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|