C45H72 — CID 159624345
1,2,3,4,5-pentamethyl-6-(2-methylpropyl)benzene (PubChem CID 159624345) has the molecular formula C45H72 and a molecular weight of 613.07 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-(2-methylpropyl)benzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 159624345 |
| Molecular Formula | C45H72 |
| Molecular Weight | 613.07 g/mol |
| Exact Mass | 612.56 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-(2-methylpropyl)benzene |
| SMILES | Cc1c(C)c(C)c(CC(C)C)c(C)c1C.Cc1c(C)c(C)c(CC(C)C)c(C)c1C.Cc1c(C)c(C)c(CC(C)C)c(C)c1C |
| InChI | InChI=1S/3C15H24/c3*1-9(2)8-15-13(6)11(4)10(3)12(5)14(15)7/h3*9H,8H2,1-7H3 |
| InChIKey | MOHHZWGXTNAXTB-UHFFFAOYSA-N |
| XLogP | 13.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.07 |
| LogP ≤ 5 | 13.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |