C22H20F2N6O2Si — CID 159626367
4,6-difluoro-1-methyl-N-[3-(5-trimethylsilyl-1,2-oxazol-3-yl)-1H-indazol-5-yl]indazole-5-carboxamide (PubChem CID 159626367) has the molecular formula C22H20F2N6O2Si and a molecular weight of 466.52 g/mol. Its IUPAC name is 4,6-difluoro-1-methyl-N-[3-(5-trimethylsilyl-1,2-oxazol-3-yl)-1H-indazol-5-yl]indazole-5-carboxamide.
| Compound Name | 4,6-difluoro-1-methyl-N-[3-(5-trimethylsilyl-1,2-oxazol-3-yl)-1H-indazol-5-yl]indazole-5-carboxamide |
|---|---|
| PubChem CID | 159626367 |
| Molecular Formula | C22H20F2N6O2Si |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 4,6-difluoro-1-methyl-N-[3-(5-trimethylsilyl-1,2-oxazol-3-yl)-1H-indazol-5-yl]indazole-5-carboxamide |
| SMILES | Cn1ncc2c(F)c(C(=O)Nc3ccc4[nH]nc(-c5cc([Si](C)(C)C)on5)c4c3)c(F)cc21 |
| InChI | InChI=1S/C22H20F2N6O2Si/c1-30-17-8-14(23)19(20(24)13(17)10-25-30)22(31)26-11-5-6-15-12(7-11)21(28-27-15)16-9-18(32-29-16)33(2,3)4/h5-10H,1-4H3,(H,26,31)(H,27,28) |
| InChIKey | MONTXFDDPVCZDR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|