C27H21F10N3O3 — CID 159626530
4-hydroxybenzonitrile;4-(2,2,3,3,3-pentafluoropropoxy)benzonitrile;[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]methanamine (PubChem CID 159626530) has the molecular formula C27H21F10N3O3 and a molecular weight of 625.46 g/mol. Its IUPAC name is 4-hydroxybenzonitrile;4-(2,2,3,3,3-pentafluoropropoxy)benzonitrile;[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]methanamine.
| Compound Name | 4-hydroxybenzonitrile;4-(2,2,3,3,3-pentafluoropropoxy)benzonitrile;[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 159626530 |
| Molecular Formula | C27H21F10N3O3 |
| Molecular Weight | 625.46 g/mol |
| Exact Mass | 625.14 |
| IUPAC Name | 4-hydroxybenzonitrile;4-(2,2,3,3,3-pentafluoropropoxy)benzonitrile;[4-(2,2,3,3,3-pentafluoropropoxy)phenyl]methanamine |
| SMILES | N#Cc1ccc(O)cc1.N#Cc1ccc(OCC(F)(F)C(F)(F)F)cc1.NCc1ccc(OCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H10F5NO.C10H6F5NO.C7H5NO/c2*11-9(12,10(13,14)15)6-17-8-3-1-7(5-16)2-4-8;8-5-6-1-3-7(9)4-2-6/h1-4H,5-6,16H2;1-4H,6H2;1-4,9H |
| InChIKey | MOOJFXWICIJFGS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.46 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|