About 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide
4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide (PubChem CID 159627666) has the molecular formula C12H14ClNO2S
and a molecular weight of 271.77 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide |
| PubChem CID | 159627666 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide |
| SMILES | CN1CC=C(c2ccc(Cl)cc2)CC1.O=S=O |
| InChI | InChI=1S/C12H14ClN.O2S/c1-14-8-6-11(7-9-14)10-2-4-12(13)5-3-10;1-3-2/h2-6H,7-9H2,1H3; |
| InChIKey | MOSCGPJJRRFCEF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide?
The IUPAC name of 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide (CID 159627666) is 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide.
What is the SMILES notation for 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide?
The canonical SMILES for 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide is CN1CC=C(c2ccc(Cl)cc2)CC1.O=S=O.
What is the InChIKey of 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide?
The InChIKey is MOSCGPJJRRFCEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClN.O2S/c1-14-8-6-11(7-9-14)10-2-4-12(13)5-3-10;1-3-2/h2-6H,7-9H2,1H3;.
What are the key properties of 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide?
4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide has a molecular weight of 271.77 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-1-methyl-3,6-dihydro-2H-pyridine;sulfur dioxide is sourced from PubChem (CID 159627666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).