C29H42O5 — CID 159627995
[(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] (2R)-oxolane-2-carboxylate (PubChem CID 159627995) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is [(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] (2R)-oxolane-2-carboxylate.
| Compound Name | [(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] (2R)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 159627995 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | [(6aR,10aR)-6,6-dimethyl-3-(2-methyloctan-2-yl)-9-oxo-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-1-yl] (2R)-oxolane-2-carboxylate |
| SMILES | CCCCCCC(C)(C)c1cc(OC(=O)[C@H]2CCCO2)c2c(c1)OC(C)(C)[C@@H]1CCC(=O)C[C@@H]21 |
| InChI | InChI=1S/C29H42O5/c1-6-7-8-9-14-28(2,3)19-16-24(33-27(31)23-11-10-15-32-23)26-21-18-20(30)12-13-22(21)29(4,5)34-25(26)17-19/h16-17,21-23H,6-15,18H2,1-5H3/t21-,22-,23-/m1/s1 |
| InChIKey | XGSUSWYXUCSZOM-DNVJHFABSA-N |
| XLogP | 6.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|