About CID 159628034
CID 159628034 (PubChem CID 159628034) has the molecular formula C22H30N6O3S+2
and a molecular weight of 458.59 g/mol.
Molecular Properties
| Compound Name | CID 159628034 |
| PubChem CID | 159628034 |
| Molecular Formula | C22H30N6O3S+2 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | — |
| SMILES | Cc1[nH][n+](C)c(C)c1N[S+](=O)(O)c1ccc(NCc2ccc(N3CCOCC3)cc2)nc1 |
| InChI | InChI=1S/C22H28N6O3S/c1-16-22(17(2)27(3)25-16)26-32(29,30)20-8-9-21(24-15-20)23-14-18-4-6-19(7-5-18)28-10-12-31-13-11-28/h4-9,15H,10-14H2,1-3H3,(H2-,23,24,26,29,30)/p+2 |
| InChIKey | CKUSQJKLCJBAKZ-UHFFFAOYSA-P |
| XLogP | 2.66 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze CID 159628034 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159628034?
The IUPAC name of CID 159628034 (CID 159628034) is not available.
What is the SMILES notation for CID 159628034?
The canonical SMILES for CID 159628034 is Cc1[nH][n+](C)c(C)c1N[S+](=O)(O)c1ccc(NCc2ccc(N3CCOCC3)cc2)nc1.
What is the InChIKey of CID 159628034?
The InChIKey is CKUSQJKLCJBAKZ-UHFFFAOYSA-P. The full InChI is InChI=1S/C22H28N6O3S/c1-16-22(17(2)27(3)25-16)26-32(29,30)20-8-9-21(24-15-20)23-14-18-4-6-19(7-5-18)28-10-12-31-13-11-28/h4-9,15H,10-14H2,1-3H3,(H2-,23,24,26,29,30)/p+2.
What are the key properties of CID 159628034?
CID 159628034 has a molecular weight of 458.59 g/mol, XLogP of 2.66, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159628034 is sourced from PubChem (CID 159628034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).