C8H12N2O — CID 159628309
2,4,5,6,7,8-hexahydro-1H-1,6-naphthyridin-3-one (PubChem CID 159628309) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is 2,4,5,6,7,8-hexahydro-1H-1,6-naphthyridin-3-one.
| Compound Name | 2,4,5,6,7,8-hexahydro-1H-1,6-naphthyridin-3-one |
|---|---|
| PubChem CID | 159628309 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 2,4,5,6,7,8-hexahydro-1H-1,6-naphthyridin-3-one |
| SMILES | O=C1CNC2=C(CNCC2)C1 |
| InChI | InChI=1S/C8H12N2O/c11-7-3-6-4-9-2-1-8(6)10-5-7/h9-10H,1-5H2 |
| InChIKey | GCKLXDRAQYAEDR-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |