C43H48O8 — CID 159629981
tert-butyl 4-[4-[(1E,6E)-7-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]naphthalen-1-yl]-3,5-dioxohepta-1,6-dienyl]naphthalen-1-yl]oxybutanoate (PubChem CID 159629981) has the molecular formula C43H48O8 and a molecular weight of 692.85 g/mol. Its IUPAC name is tert-butyl 4-[4-[(1E,6E)-7-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]naphthalen-1-yl]-3,5-dioxohepta-1,6-dienyl]naphthalen-1-yl]oxybutanoate.
| Compound Name | tert-butyl 4-[4-[(1E,6E)-7-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]naphthalen-1-yl]-3,5-dioxohepta-1,6-dienyl]naphthalen-1-yl]oxybutanoate |
|---|---|
| PubChem CID | 159629981 |
| Molecular Formula | C43H48O8 |
| Molecular Weight | 692.85 g/mol |
| Exact Mass | 692.33 |
| IUPAC Name | tert-butyl 4-[4-[(1E,6E)-7-[4-[4-[(2-methylpropan-2-yl)oxy]-4-oxobutoxy]naphthalen-1-yl]-3,5-dioxohepta-1,6-dienyl]naphthalen-1-yl]oxybutanoate |
| SMILES | CC(C)(C)OC(=O)CCCOc1ccc(/C=C/C(=O)CC(=O)/C=C/c2ccc(OCCCC(=O)OC(C)(C)C)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C43H48O8/c1-42(2,3)50-40(46)17-11-27-48-38-25-21-30(34-13-7-9-15-36(34)38)19-23-32(44)29-33(45)24-20-31-22-26-39(37-16-10-8-14-35(31)37)49-28-12-18-41(47)51-43(4,5)6/h7-10,13-16,19-26H,11-12,17-18,27-29H2,1-6H3/b23-19+,24-20+ |
| InChIKey | MOZMNMQDYHWDRN-BLVCXSLXSA-N |
| XLogP | 9.25 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.85 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|