About azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate
azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate (PubChem CID 159630213) has the molecular formula C9H16FN2O4S-
and a molecular weight of 267.30 g/mol. Its IUPAC name is azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate.
Molecular Properties
| Compound Name | azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate |
| PubChem CID | 159630213 |
| Molecular Formula | C9H16FN2O4S- |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate |
| SMILES | CS(=O)[O-].O=CN1CC(F)C1.O=CN1CCC1 |
| InChI | InChI=1S/C4H6FNO.C4H7NO.CH4O2S/c5-4-1-6(2-4)3-7;6-4-5-2-1-3-5;1-4(2)3/h3-4H,1-2H2;4H,1-3H2;1H3,(H,2,3)/p-1 |
| InChIKey | IACVUPLFVQAVKI-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate?
The IUPAC name of azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate (CID 159630213) is azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate.
What is the SMILES notation for azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate?
The canonical SMILES for azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate is CS(=O)[O-].O=CN1CC(F)C1.O=CN1CCC1.
What is the InChIKey of azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate?
The InChIKey is IACVUPLFVQAVKI-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H6FNO.C4H7NO.CH4O2S/c5-4-1-6(2-4)3-7;6-4-5-2-1-3-5;1-4(2)3/h3-4H,1-2H2;4H,1-3H2;1H3,(H,2,3)/p-1.
What are the key properties of azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate?
azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate has a molecular weight of 267.30 g/mol, XLogP of -0.86, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine-1-carbaldehyde;3-fluoroazetidine-1-carbaldehyde;methanesulfinate is sourced from PubChem (CID 159630213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).