C17H26I2V — CID 159630672
diiodovanadium;9,9,11,11-tetramethyltetracyclo[6.3.1.13,6.02,7]tridec-4-ene (PubChem CID 159630672) has the molecular formula C17H26I2V and a molecular weight of 535.15 g/mol. Its IUPAC name is diiodovanadium;9,9,11,11-tetramethyltetracyclo[6.3.1.13,6.02,7]tridec-4-ene.
| Compound Name | diiodovanadium;9,9,11,11-tetramethyltetracyclo[6.3.1.13,6.02,7]tridec-4-ene |
|---|---|
| PubChem CID | 159630672 |
| Molecular Formula | C17H26I2V |
| Molecular Weight | 535.15 g/mol |
| Exact Mass | 534.96 |
| IUPAC Name | diiodovanadium;9,9,11,11-tetramethyltetracyclo[6.3.1.13,6.02,7]tridec-4-ene |
| SMILES | CC1(C)CC(C)(C)C2CC1C1C3C=CC(C3)C12.I[V]I |
| InChI | InChI=1S/C17H26.2HI.V/c1-16(2)9-17(3,4)13-8-12(16)14-10-5-6-11(7-10)15(13)14;;;/h5-6,10-15H,7-9H2,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | MPBUNOGUBAXMMH-UHFFFAOYSA-L |
| XLogP | 6.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.15 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|