C48H82N4O4Si — CID 159630745
1-[(Z)-10-[tert-butyl(diphenyl)silyl]oxydec-5-enyl]-3-pentylurea;1-[(Z)-10-hydroxydec-5-enyl]-3-pentylurea (PubChem CID 159630745) has the molecular formula C48H82N4O4Si and a molecular weight of 807.29 g/mol. Its IUPAC name is 1-[(Z)-10-[tert-butyl(diphenyl)silyl]oxydec-5-enyl]-3-pentylurea;1-[(Z)-10-hydroxydec-5-enyl]-3-pentylurea.
| Compound Name | 1-[(Z)-10-[tert-butyl(diphenyl)silyl]oxydec-5-enyl]-3-pentylurea;1-[(Z)-10-hydroxydec-5-enyl]-3-pentylurea |
|---|---|
| PubChem CID | 159630745 |
| Molecular Formula | C48H82N4O4Si |
| Molecular Weight | 807.29 g/mol |
| Exact Mass | 806.61 |
| IUPAC Name | 1-[(Z)-10-[tert-butyl(diphenyl)silyl]oxydec-5-enyl]-3-pentylurea;1-[(Z)-10-hydroxydec-5-enyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NCCCC/C=C\CCCCO.CCCCCNC(=O)NCCCC/C=C\CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H50N2O2Si.C16H32N2O2/c1-5-6-19-26-33-31(35)34-27-20-11-9-7-8-10-12-21-28-36-37(32(2,3)4,29-22-15-13-16-23-29)30-24-17-14-18-25-30;1-2-3-10-13-17-16(20)18-14-11-8-6-4-5-7-9-12-15-19/h7-8,13-18,22-25H,5-6,9-12,19-21,26-28H2,1-4H3,(H2,33,34,35);4-5,19H,2-3,6-15H2,1H3,(H2,17,18,20)/b8-7-;5-4- |
| InChIKey | MPCAQFOBOMKILV-ZEEJSZFOSA-N |
| XLogP | 10.31 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.29 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|