C46H68N4O4 — CID 159630951
1-(4-prop-2-ynylpiperazin-1-yl)-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanone (PubChem CID 159630951) has the molecular formula C46H68N4O4 and a molecular weight of 741.07 g/mol. Its IUPAC name is 1-(4-prop-2-ynylpiperazin-1-yl)-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanone.
| Compound Name | 1-(4-prop-2-ynylpiperazin-1-yl)-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanone |
|---|---|
| PubChem CID | 159630951 |
| Molecular Formula | C46H68N4O4 |
| Molecular Weight | 741.07 g/mol |
| Exact Mass | 740.52 |
| IUPAC Name | 1-(4-prop-2-ynylpiperazin-1-yl)-2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanone |
| SMILES | C#CCN1CCN(C(=O)COc2ccc(C(C)(C)CC(C)(C)C)cc2)CC1.C#CCN1CCN(C(=O)COc2ccc(C(C)(C)CC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/2C23H34N2O2/c2*1-7-12-24-13-15-25(16-14-24)21(26)17-27-20-10-8-19(9-11-20)23(5,6)18-22(2,3)4/h2*1,8-11H,12-18H2,2-6H3 |
| InChIKey | MPCQTJQBDQCXGV-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.07 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|